About naphthalene-2,6-dicarbaldehyde
naphthalene-2,6-dicarbaldehyde (PubChem CID 159038637) has the molecular formula C24H16O4
and a molecular weight of 368.39 g/mol. Its IUPAC name is naphthalene-2,6-dicarbaldehyde.
Molecular Properties
| Compound Name | naphthalene-2,6-dicarbaldehyde |
| PubChem CID | 159038637 |
| Molecular Formula | C24H16O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | naphthalene-2,6-dicarbaldehyde |
| SMILES | O=Cc1ccc2cc(C=O)ccc2c1.O=Cc1ccc2cc(C=O)ccc2c1 |
| InChI | InChI=1S/2C12H8O2/c2*13-7-9-1-3-11-6-10(8-14)2-4-12(11)5-9/h2*1-8H |
| InChIKey | JVTOEOKOYHVCJW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze naphthalene-2,6-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene-2,6-dicarbaldehyde?
The IUPAC name of naphthalene-2,6-dicarbaldehyde (CID 159038637) is naphthalene-2,6-dicarbaldehyde.
What is the SMILES notation for naphthalene-2,6-dicarbaldehyde?
The canonical SMILES for naphthalene-2,6-dicarbaldehyde is O=Cc1ccc2cc(C=O)ccc2c1.O=Cc1ccc2cc(C=O)ccc2c1.
What is the InChIKey of naphthalene-2,6-dicarbaldehyde?
The InChIKey is JVTOEOKOYHVCJW-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H8O2/c2*13-7-9-1-3-11-6-10(8-14)2-4-12(11)5-9/h2*1-8H.
What are the key properties of naphthalene-2,6-dicarbaldehyde?
naphthalene-2,6-dicarbaldehyde has a molecular weight of 368.39 g/mol, XLogP of 4.93, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene-2,6-dicarbaldehyde is sourced from PubChem (CID 159038637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).