C10H15ClN2S — CID 2299864
N'-[2-(4-chlorophenyl)sulfanylethyl]ethane-1,2-diamine (PubChem CID 2299864) has the molecular formula C10H15ClN2S and a molecular weight of 230.76 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)sulfanylethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-(4-chlorophenyl)sulfanylethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 2299864 |
| Molecular Formula | C10H15ClN2S |
| Molecular Weight | 230.76 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | N'-[2-(4-chlorophenyl)sulfanylethyl]ethane-1,2-diamine |
| SMILES | NCCNCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H15ClN2S/c11-9-1-3-10(4-2-9)14-8-7-13-6-5-12/h1-4,13H,5-8,12H2 |
| InChIKey | UQDZRJIDRVLCRX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.76 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|