C13H8F6O3S — CID 89249717
1,1,1,3,3,3-hexafluoro-2-naphthalen-2-ylpropane-2-sulfonic acid (PubChem CID 89249717) has the molecular formula C13H8F6O3S and a molecular weight of 358.26 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-naphthalen-2-ylpropane-2-sulfonic acid.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-naphthalen-2-ylpropane-2-sulfonic acid |
|---|---|
| PubChem CID | 89249717 |
| Molecular Formula | C13H8F6O3S |
| Molecular Weight | 358.26 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-naphthalen-2-ylpropane-2-sulfonic acid |
| SMILES | O=S(=O)(O)C(c1ccc2ccccc2c1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H8F6O3S/c14-12(15,16)11(13(17,18)19,23(20,21)22)10-6-5-8-3-1-2-4-9(8)7-10/h1-7H,(H,20,21,22) |
| InChIKey | JTKZNXWCEULGQP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.26 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|