C12H18O5S — CID 141158801
[(1S)-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]ethyl] hydrogen sulfate (PubChem CID 141158801) has the molecular formula C12H18O5S and a molecular weight of 274.34 g/mol. Its IUPAC name is [(1S)-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]ethyl] hydrogen sulfate.
| Compound Name | [(1S)-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]ethyl] hydrogen sulfate |
|---|---|
| PubChem CID | 141158801 |
| Molecular Formula | C12H18O5S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | [(1S)-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]ethyl] hydrogen sulfate |
| SMILES | C[C@H](OS(=O)(=O)O)c1ccc(OC(C)(C)C)cc1 |
| InChI | InChI=1S/C12H18O5S/c1-9(17-18(13,14)15)10-5-7-11(8-6-10)16-12(2,3)4/h5-9H,1-4H3,(H,13,14,15)/t9-/m0/s1 |
| InChIKey | BSESVKXZIZVVTF-VIFPVBQESA-N |
| XLogP | 2.74 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|