C26H27F2O6PS — CID 160736993
1-[1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethoxy]ethanesulfonate;triphenylphosphanium (PubChem CID 160736993) has the molecular formula C26H27F2O6PS and a molecular weight of 536.53 g/mol. Its IUPAC name is 1-[1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethoxy]ethanesulfonate;triphenylphosphanium.
| Compound Name | 1-[1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethoxy]ethanesulfonate;triphenylphosphanium |
|---|---|
| PubChem CID | 160736993 |
| Molecular Formula | C26H27F2O6PS |
| Molecular Weight | 536.53 g/mol |
| Exact Mass | 536.12 |
| IUPAC Name | 1-[1,1-difluoro-2-(2-methylprop-2-enoyloxy)ethoxy]ethanesulfonate;triphenylphosphanium |
| SMILES | C=C(C)C(=O)OCC(F)(F)OC(C)S(=O)(=O)[O-].c1ccc([PH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C8H12F2O6S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-5(2)7(11)15-4-8(9,10)16-6(3)17(12,13)14/h1-15H;6H,1,4H2,2-3H3,(H,12,13,14) |
| InChIKey | RVBWGFDFWADJEO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|