C24H24F2O5S3 — CID 174988276
(2,2-difluoro-2-sulfanylethyl) 2-methylprop-2-enoate;[diphenyl(sulfo)-λ4-sulfanyl]benzene (PubChem CID 174988276) has the molecular formula C24H24F2O5S3 and a molecular weight of 526.65 g/mol. Its IUPAC name is (2,2-difluoro-2-sulfanylethyl) 2-methylprop-2-enoate;[diphenyl(sulfo)-λ4-sulfanyl]benzene.
| Compound Name | (2,2-difluoro-2-sulfanylethyl) 2-methylprop-2-enoate;[diphenyl(sulfo)-λ4-sulfanyl]benzene |
|---|---|
| PubChem CID | 174988276 |
| Molecular Formula | C24H24F2O5S3 |
| Molecular Weight | 526.65 g/mol |
| Exact Mass | 526.08 |
| IUPAC Name | (2,2-difluoro-2-sulfanylethyl) 2-methylprop-2-enoate;[diphenyl(sulfo)-λ4-sulfanyl]benzene |
| SMILES | C=C(C)C(=O)OCC(F)(F)S.O=S(=O)(O)S(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H16O3S2.C6H8F2O2S/c19-23(20,21)22(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4(2)5(9)10-3-6(7,8)11/h1-15H,(H,19,20,21);11H,1,3H2,2H3 |
| InChIKey | BBDCPFNRXNOFGV-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.65 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|