C28H32F2O6S2 — CID 123329091
[2-[dihydroxy-[[4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenyl-λ4-sulfanyl]-oxo-λ6-sulfanyl]-2,2-difluoroethyl] 2-methylprop-2-enoate (PubChem CID 123329091) has the molecular formula C28H32F2O6S2 and a molecular weight of 566.69 g/mol. Its IUPAC name is [2-[dihydroxy-[[4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenyl-λ4-sulfanyl]-oxo-λ6-sulfanyl]-2,2-difluoroethyl] 2-methylprop-2-enoate.
| Compound Name | [2-[dihydroxy-[[4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenyl-λ4-sulfanyl]-oxo-λ6-sulfanyl]-2,2-difluoroethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123329091 |
| Molecular Formula | C28H32F2O6S2 |
| Molecular Weight | 566.69 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | [2-[dihydroxy-[[4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenyl-λ4-sulfanyl]-oxo-λ6-sulfanyl]-2,2-difluoroethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(F)(F)S(=O)(O)(O)S(c1ccccc1)(c1ccccc1)c1ccc(OC(C)(C)C)cc1 |
| InChI | InChI=1S/C28H32F2O6S2/c1-21(2)26(31)35-20-28(29,30)38(32,33,34)37(23-12-8-6-9-13-23,24-14-10-7-11-15-24)25-18-16-22(17-19-25)36-27(3,4)5/h6-19H,1,20H2,2-5H3,(H2,32,33,34) |
| InChIKey | ACZJOKUANYSQQJ-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.69 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|