C31H32F2O7S2 — CID 123520514
[5-[2-[dihydroxy-oxo-(triphenyl-λ4-sulfanyl)-λ6-sulfanyl]-2,2-difluoroacetyl]oxy-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate (PubChem CID 123520514) has the molecular formula C31H32F2O7S2 and a molecular weight of 618.72 g/mol. Its IUPAC name is [5-[2-[dihydroxy-oxo-(triphenyl-λ4-sulfanyl)-λ6-sulfanyl]-2,2-difluoroacetyl]oxy-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate.
| Compound Name | [5-[2-[dihydroxy-oxo-(triphenyl-λ4-sulfanyl)-λ6-sulfanyl]-2,2-difluoroacetyl]oxy-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123520514 |
| Molecular Formula | C31H32F2O7S2 |
| Molecular Weight | 618.72 g/mol |
| Exact Mass | 618.16 |
| IUPAC Name | [5-[2-[dihydroxy-oxo-(triphenyl-λ4-sulfanyl)-λ6-sulfanyl]-2,2-difluoroacetyl]oxy-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CC2CC1CC2OC(=O)C(F)(F)S(=O)(O)(O)S(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H32F2O7S2/c1-21(2)29(34)39-27-19-23-18-22(27)20-28(23)40-30(35)31(32,33)42(36,37,38)41(24-12-6-3-7-13-24,25-14-8-4-9-15-25)26-16-10-5-11-17-26/h3-17,22-23,27-28H,1,18-20H2,2H3,(H2,36,37,38) |
| InChIKey | RBUZTHLZYNGMER-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.72 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|