C28H30F2O7S2 — CID 123752795
4-[2-[dihydroxy-oxo-(triphenyl-λ4-sulfanyl)-λ6-sulfanyl]-2,2-difluoroacetyl]oxybutyl 2-methylprop-2-enoate (PubChem CID 123752795) has the molecular formula C28H30F2O7S2 and a molecular weight of 580.67 g/mol. Its IUPAC name is 4-[2-[dihydroxy-oxo-(triphenyl-λ4-sulfanyl)-λ6-sulfanyl]-2,2-difluoroacetyl]oxybutyl 2-methylprop-2-enoate.
| Compound Name | 4-[2-[dihydroxy-oxo-(triphenyl-λ4-sulfanyl)-λ6-sulfanyl]-2,2-difluoroacetyl]oxybutyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123752795 |
| Molecular Formula | C28H30F2O7S2 |
| Molecular Weight | 580.67 g/mol |
| Exact Mass | 580.14 |
| IUPAC Name | 4-[2-[dihydroxy-oxo-(triphenyl-λ4-sulfanyl)-λ6-sulfanyl]-2,2-difluoroacetyl]oxybutyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCOC(=O)C(F)(F)S(=O)(O)(O)S(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H30F2O7S2/c1-22(2)26(31)36-20-12-13-21-37-27(32)28(29,30)39(33,34,35)38(23-14-6-3-7-15-23,24-16-8-4-9-17-24)25-18-10-5-11-19-25/h3-11,14-19H,1,12-13,20-21H2,2H3,(H2,33,34,35) |
| InChIKey | KLVPJCXCHJLJPD-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.67 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|