C30H34F2O7S2 — CID 123445507
[2-[2-[[(4-tert-butylphenyl)-diphenyl-λ4-sulfanyl]-dihydroxy-oxo-λ6-sulfanyl]-2,2-difluoroethoxy]-2-oxoethyl] 2-methylprop-2-enoate (PubChem CID 123445507) has the molecular formula C30H34F2O7S2 and a molecular weight of 608.72 g/mol. Its IUPAC name is [2-[2-[[(4-tert-butylphenyl)-diphenyl-λ4-sulfanyl]-dihydroxy-oxo-λ6-sulfanyl]-2,2-difluoroethoxy]-2-oxoethyl] 2-methylprop-2-enoate.
| Compound Name | [2-[2-[[(4-tert-butylphenyl)-diphenyl-λ4-sulfanyl]-dihydroxy-oxo-λ6-sulfanyl]-2,2-difluoroethoxy]-2-oxoethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123445507 |
| Molecular Formula | C30H34F2O7S2 |
| Molecular Weight | 608.72 g/mol |
| Exact Mass | 608.17 |
| IUPAC Name | [2-[2-[[(4-tert-butylphenyl)-diphenyl-λ4-sulfanyl]-dihydroxy-oxo-λ6-sulfanyl]-2,2-difluoroethoxy]-2-oxoethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(=O)OCC(F)(F)S(=O)(O)(O)S(c1ccccc1)(c1ccccc1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H34F2O7S2/c1-22(2)28(34)38-20-27(33)39-21-30(31,32)41(35,36,37)40(24-12-8-6-9-13-24,25-14-10-7-11-15-25)26-18-16-23(17-19-26)29(3,4)5/h6-19H,1,20-21H2,2-5H3,(H2,35,36,37) |
| InChIKey | KPNOCZHRGPEUCJ-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.72 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|