C14H12F3NO4 — CID 76686680
[2-oxo-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]oxyethyl] 2-methylprop-2-enoate (PubChem CID 76686680) has the molecular formula C14H12F3NO4 and a molecular weight of 315.25 g/mol. Its IUPAC name is [2-oxo-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]oxyethyl] 2-methylprop-2-enoate.
| Compound Name | [2-oxo-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]oxyethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 76686680 |
| Molecular Formula | C14H12F3NO4 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | [2-oxo-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]oxyethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(=O)ON=C(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C14H12F3NO4/c1-9(2)13(20)21-8-11(19)22-18-12(14(15,16)17)10-6-4-3-5-7-10/h3-7H,1,8H2,2H3 |
| InChIKey | CMIRRTVLWAQSMK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|