C13H10F3NO4 — CID 58070606
[2-oxo-2-[(E)-(2,2,2-trifluoro-1-phenylethylidene)amino]oxyethyl] prop-2-enoate (PubChem CID 58070606) has the molecular formula C13H10F3NO4 and a molecular weight of 301.22 g/mol. Its IUPAC name is [2-oxo-2-[(E)-(2,2,2-trifluoro-1-phenylethylidene)amino]oxyethyl] prop-2-enoate.
| Compound Name | [2-oxo-2-[(E)-(2,2,2-trifluoro-1-phenylethylidene)amino]oxyethyl] prop-2-enoate |
|---|---|
| PubChem CID | 58070606 |
| Molecular Formula | C13H10F3NO4 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | [2-oxo-2-[(E)-(2,2,2-trifluoro-1-phenylethylidene)amino]oxyethyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(=O)O/N=C(\c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H10F3NO4/c1-2-10(18)20-8-11(19)21-17-12(13(14,15)16)9-6-4-3-5-7-9/h2-7H,1,8H2/b17-12+ |
| InChIKey | UVZYCHUXALDIHX-SFQUDFHCSA-N |
| XLogP | 2.23 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|