C16H15F3O8 — CID 177277233
[2-(2-hydroxy-3-prop-2-enoyloxypropoxy)-2-oxoethyl] 2-(trifluoromethoxy)benzoate (PubChem CID 177277233) has the molecular formula C16H15F3O8 and a molecular weight of 392.28 g/mol. Its IUPAC name is [2-(2-hydroxy-3-prop-2-enoyloxypropoxy)-2-oxoethyl] 2-(trifluoromethoxy)benzoate.
| Compound Name | [2-(2-hydroxy-3-prop-2-enoyloxypropoxy)-2-oxoethyl] 2-(trifluoromethoxy)benzoate |
|---|---|
| PubChem CID | 177277233 |
| Molecular Formula | C16H15F3O8 |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | [2-(2-hydroxy-3-prop-2-enoyloxypropoxy)-2-oxoethyl] 2-(trifluoromethoxy)benzoate |
| SMILES | C=CC(=O)OCC(O)COC(=O)COC(=O)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C16H15F3O8/c1-2-13(21)24-7-10(20)8-25-14(22)9-26-15(23)11-5-3-4-6-12(11)27-16(17,18)19/h2-6,10,20H,1,7-9H2 |
| InChIKey | WVRYHJYPJOXZAO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|