C18H13F3O2 — CID 101033414
1,1-diphenylbuta-1,3-dien-2-yl 2,2,2-trifluoroacetate (PubChem CID 101033414) has the molecular formula C18H13F3O2 and a molecular weight of 318.29 g/mol. Its IUPAC name is 1,1-diphenylbuta-1,3-dien-2-yl 2,2,2-trifluoroacetate.
| Compound Name | 1,1-diphenylbuta-1,3-dien-2-yl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 101033414 |
| Molecular Formula | C18H13F3O2 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 1,1-diphenylbuta-1,3-dien-2-yl 2,2,2-trifluoroacetate |
| SMILES | C=CC(OC(=O)C(F)(F)F)=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H13F3O2/c1-2-15(23-17(22)18(19,20)21)16(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h2-12H,1H2 |
| InChIKey | ZJLHBAODDBSYSF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|