C10H7F6NO3 — CID 87606845
benzamide;trifluoromethyl 2,2,2-trifluoroacetate (PubChem CID 87606845) has the molecular formula C10H7F6NO3 and a molecular weight of 303.16 g/mol. Its IUPAC name is benzamide;trifluoromethyl 2,2,2-trifluoroacetate.
| Compound Name | benzamide;trifluoromethyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87606845 |
| Molecular Formula | C10H7F6NO3 |
| Molecular Weight | 303.16 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | benzamide;trifluoromethyl 2,2,2-trifluoroacetate |
| SMILES | NC(=O)c1ccccc1.O=C(OC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H7NO.C3F6O2/c8-7(9)6-4-2-1-3-5-6;4-2(5,6)1(10)11-3(7,8)9/h1-5H,(H2,8,9); |
| InChIKey | SLOAAHYFTNGLDV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.16 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |