About benzamide;trifluoro(methylsulfanyl)methane
benzamide;trifluoro(methylsulfanyl)methane (PubChem CID 167473170) has the molecular formula C9H10F3NOS
and a molecular weight of 237.25 g/mol. Its IUPAC name is benzamide;trifluoro(methylsulfanyl)methane.
Molecular Properties
| Compound Name | benzamide;trifluoro(methylsulfanyl)methane |
| PubChem CID | 167473170 |
| Molecular Formula | C9H10F3NOS |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | benzamide;trifluoro(methylsulfanyl)methane |
| SMILES | CSC(F)(F)F.NC(=O)c1ccccc1 |
| InChI | InChI=1S/C7H7NO.C2H3F3S/c8-7(9)6-4-2-1-3-5-6;1-6-2(3,4)5/h1-5H,(H2,8,9);1H3 |
| InChIKey | AAEIRRXRUOLWPY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzamide;trifluoro(methylsulfanyl)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamide;trifluoro(methylsulfanyl)methane?
The IUPAC name of benzamide;trifluoro(methylsulfanyl)methane (CID 167473170) is benzamide;trifluoro(methylsulfanyl)methane.
What is the SMILES notation for benzamide;trifluoro(methylsulfanyl)methane?
The canonical SMILES for benzamide;trifluoro(methylsulfanyl)methane is CSC(F)(F)F.NC(=O)c1ccccc1.
What is the InChIKey of benzamide;trifluoro(methylsulfanyl)methane?
The InChIKey is AAEIRRXRUOLWPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO.C2H3F3S/c8-7(9)6-4-2-1-3-5-6;1-6-2(3,4)5/h1-5H,(H2,8,9);1H3.
What are the key properties of benzamide;trifluoro(methylsulfanyl)methane?
benzamide;trifluoro(methylsulfanyl)methane has a molecular weight of 237.25 g/mol, XLogP of 2.65, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzamide;trifluoro(methylsulfanyl)methane is sourced from PubChem (CID 167473170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).