About fluorobenzene;4-methylsulfanylbenzamide
fluorobenzene;4-methylsulfanylbenzamide (PubChem CID 143044718) has the molecular formula C14H14FNOS
and a molecular weight of 263.34 g/mol. Its IUPAC name is fluorobenzene;4-methylsulfanylbenzamide.
Molecular Properties
| Compound Name | fluorobenzene;4-methylsulfanylbenzamide |
| PubChem CID | 143044718 |
| Molecular Formula | C14H14FNOS |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | fluorobenzene;4-methylsulfanylbenzamide |
| SMILES | CSc1ccc(C(N)=O)cc1.Fc1ccccc1 |
| InChI | InChI=1S/C8H9NOS.C6H5F/c1-11-7-4-2-6(3-5-7)8(9)10;7-6-4-2-1-3-5-6/h2-5H,1H3,(H2,9,10);1-5H |
| InChIKey | GPUMJTCUYDZVMQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze fluorobenzene;4-methylsulfanylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluorobenzene;4-methylsulfanylbenzamide?
The IUPAC name of fluorobenzene;4-methylsulfanylbenzamide (CID 143044718) is fluorobenzene;4-methylsulfanylbenzamide.
What is the SMILES notation for fluorobenzene;4-methylsulfanylbenzamide?
The canonical SMILES for fluorobenzene;4-methylsulfanylbenzamide is CSc1ccc(C(N)=O)cc1.Fc1ccccc1.
What is the InChIKey of fluorobenzene;4-methylsulfanylbenzamide?
The InChIKey is GPUMJTCUYDZVMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NOS.C6H5F/c1-11-7-4-2-6(3-5-7)8(9)10;7-6-4-2-1-3-5-6/h2-5H,1H3,(H2,9,10);1-5H.
What are the key properties of fluorobenzene;4-methylsulfanylbenzamide?
fluorobenzene;4-methylsulfanylbenzamide has a molecular weight of 263.34 g/mol, XLogP of 3.33, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluorobenzene;4-methylsulfanylbenzamide is sourced from PubChem (CID 143044718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).