About 4-aminosulfanylbenzamide
4-aminosulfanylbenzamide (PubChem CID 22301586) has the molecular formula C7H8N2OS
and a molecular weight of 168.22 g/mol. Its IUPAC name is 4-aminosulfanylbenzamide.
Molecular Properties
| Compound Name | 4-aminosulfanylbenzamide |
| PubChem CID | 22301586 |
| Molecular Formula | C7H8N2OS |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 4-aminosulfanylbenzamide |
| SMILES | NSc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C7H8N2OS/c8-7(10)5-1-3-6(11-9)4-2-5/h1-4H,9H2,(H2,8,10) |
| InChIKey | OGYGWVWAIXGMNL-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-aminosulfanylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminosulfanylbenzamide?
The IUPAC name of 4-aminosulfanylbenzamide (CID 22301586) is 4-aminosulfanylbenzamide.
What is the SMILES notation for 4-aminosulfanylbenzamide?
The canonical SMILES for 4-aminosulfanylbenzamide is NSc1ccc(C(N)=O)cc1.
What is the InChIKey of 4-aminosulfanylbenzamide?
The InChIKey is OGYGWVWAIXGMNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2OS/c8-7(10)5-1-3-6(11-9)4-2-5/h1-4H,9H2,(H2,8,10).
What are the key properties of 4-aminosulfanylbenzamide?
4-aminosulfanylbenzamide has a molecular weight of 168.22 g/mol, XLogP of 0.75, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminosulfanylbenzamide is sourced from PubChem (CID 22301586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).