C9H12N2S — CID 163786268
(Z)-1-(4-methylsulfanylphenyl)ethene-1,2-diamine (PubChem CID 163786268) has the molecular formula C9H12N2S and a molecular weight of 180.28 g/mol. Its IUPAC name is (Z)-1-(4-methylsulfanylphenyl)ethene-1,2-diamine.
| Compound Name | (Z)-1-(4-methylsulfanylphenyl)ethene-1,2-diamine |
|---|---|
| PubChem CID | 163786268 |
| Molecular Formula | C9H12N2S |
| Molecular Weight | 180.28 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | (Z)-1-(4-methylsulfanylphenyl)ethene-1,2-diamine |
| SMILES | CSc1ccc(/C(N)=C/N)cc1 |
| InChI | InChI=1S/C9H12N2S/c1-12-8-4-2-7(3-5-8)9(11)6-10/h2-6H,10-11H2,1H3/b9-6- |
| InChIKey | MSVBIZWWEMMEJG-TWGQIWQCSA-N |
| XLogP | 1.62 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |