C24H22S2 — CID 121386952
1,3-bis[1-(4-methylsulfanylphenyl)ethenyl]benzene (PubChem CID 121386952) has the molecular formula C24H22S2 and a molecular weight of 374.57 g/mol. Its IUPAC name is 1,3-bis[1-(4-methylsulfanylphenyl)ethenyl]benzene.
| Compound Name | 1,3-bis[1-(4-methylsulfanylphenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 121386952 |
| Molecular Formula | C24H22S2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 1,3-bis[1-(4-methylsulfanylphenyl)ethenyl]benzene |
| SMILES | C=C(c1ccc(SC)cc1)c1cccc(C(=C)c2ccc(SC)cc2)c1 |
| InChI | InChI=1S/C24H22S2/c1-17(19-8-12-23(25-3)13-9-19)21-6-5-7-22(16-21)18(2)20-10-14-24(26-4)15-11-20/h5-16H,1-2H2,3-4H3 |
| InChIKey | TUELTVACKDEUST-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |