C18H26N2 — CID 54049505
ethane;4-(1-phenylethenyl)benzene-1,2-diamine (PubChem CID 54049505) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is ethane;4-(1-phenylethenyl)benzene-1,2-diamine.
| Compound Name | ethane;4-(1-phenylethenyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 54049505 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | ethane;4-(1-phenylethenyl)benzene-1,2-diamine |
| SMILES | C=C(c1ccccc1)c1ccc(N)c(N)c1.CC.CC |
| InChI | InChI=1S/C14H14N2.2C2H6/c1-10(11-5-3-2-4-6-11)12-7-8-13(15)14(16)9-12;2*1-2/h2-9H,1,15-16H2;2*1-2H3 |
| InChIKey | LRXBRCIZRAKCKY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|