C29H34N2 — CID 121386942
4-[1-[3-[1-[4-(diethylamino)phenyl]ethenyl]phenyl]ethenyl]-N-ethyl-N-methylaniline (PubChem CID 121386942) has the molecular formula C29H34N2 and a molecular weight of 410.61 g/mol. Its IUPAC name is 4-[1-[3-[1-[4-(diethylamino)phenyl]ethenyl]phenyl]ethenyl]-N-ethyl-N-methylaniline.
| Compound Name | 4-[1-[3-[1-[4-(diethylamino)phenyl]ethenyl]phenyl]ethenyl]-N-ethyl-N-methylaniline |
|---|---|
| PubChem CID | 121386942 |
| Molecular Formula | C29H34N2 |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | 4-[1-[3-[1-[4-(diethylamino)phenyl]ethenyl]phenyl]ethenyl]-N-ethyl-N-methylaniline |
| SMILES | C=C(c1ccc(N(C)CC)cc1)c1cccc(C(=C)c2ccc(N(CC)CC)cc2)c1 |
| InChI | InChI=1S/C29H34N2/c1-7-30(6)28-17-13-24(14-18-28)22(4)26-11-10-12-27(21-26)23(5)25-15-19-29(20-16-25)31(8-2)9-3/h10-21H,4-5,7-9H2,1-3,6H3 |
| InChIKey | CRDBBOZIEILKFR-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|