C13H20N2S — CID 2832387
4-(diethylamino)-N,N-dimethylbenzenecarbothioamide (PubChem CID 2832387) has the molecular formula C13H20N2S and a molecular weight of 236.38 g/mol. Its IUPAC name is 4-(diethylamino)-N,N-dimethylbenzenecarbothioamide.
| Compound Name | 4-(diethylamino)-N,N-dimethylbenzenecarbothioamide |
|---|---|
| PubChem CID | 2832387 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 4-(diethylamino)-N,N-dimethylbenzenecarbothioamide |
| SMILES | CCN(CC)c1ccc(C(=S)N(C)C)cc1 |
| InChI | InChI=1S/C13H20N2S/c1-5-15(6-2)12-9-7-11(8-10-12)13(16)14(3)4/h7-10H,5-6H2,1-4H3 |
| InChIKey | KSSLWGIGLZRETN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|