C12H18N2 — CID 146581099
4-(1-aminoethenyl)-N,N-diethylaniline (PubChem CID 146581099) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 4-(1-aminoethenyl)-N,N-diethylaniline.
| Compound Name | 4-(1-aminoethenyl)-N,N-diethylaniline |
|---|---|
| PubChem CID | 146581099 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 4-(1-aminoethenyl)-N,N-diethylaniline |
| SMILES | C=C(N)c1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C12H18N2/c1-4-14(5-2)12-8-6-11(7-9-12)10(3)13/h6-9H,3-5,13H2,1-2H3 |
| InChIKey | BZIGPXGQLHAFIF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|