C14H20N2O3 — CID 2514955
[(2S)-1-amino-1-oxopropan-2-yl] 4-(diethylamino)benzoate (PubChem CID 2514955) has the molecular formula C14H20N2O3 and a molecular weight of 264.33 g/mol. Its IUPAC name is [(2S)-1-amino-1-oxopropan-2-yl] 4-(diethylamino)benzoate.
| Compound Name | [(2S)-1-amino-1-oxopropan-2-yl] 4-(diethylamino)benzoate |
|---|---|
| PubChem CID | 2514955 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | [(2S)-1-amino-1-oxopropan-2-yl] 4-(diethylamino)benzoate |
| SMILES | CCN(CC)c1ccc(C(=O)O[C@@H](C)C(N)=O)cc1 |
| InChI | InChI=1S/C14H20N2O3/c1-4-16(5-2)12-8-6-11(7-9-12)14(18)19-10(3)13(15)17/h6-10H,4-5H2,1-3H3,(H2,15,17)/t10-/m0/s1 |
| InChIKey | RIDCBXGHNDAMMZ-JTQLQIEISA-N |
| XLogP | 1.56 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |