C12H16N2O5S — CID 46789274
(1-amino-1-oxopropan-2-yl) 4-(dimethylsulfamoyl)benzoate (PubChem CID 46789274) has the molecular formula C12H16N2O5S and a molecular weight of 300.34 g/mol. Its IUPAC name is (1-amino-1-oxopropan-2-yl) 4-(dimethylsulfamoyl)benzoate.
| Compound Name | (1-amino-1-oxopropan-2-yl) 4-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 46789274 |
| Molecular Formula | C12H16N2O5S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | (1-amino-1-oxopropan-2-yl) 4-(dimethylsulfamoyl)benzoate |
| SMILES | CC(OC(=O)c1ccc(S(=O)(=O)N(C)C)cc1)C(N)=O |
| InChI | InChI=1S/C12H16N2O5S/c1-8(11(13)15)19-12(16)9-4-6-10(7-5-9)20(17,18)14(2)3/h4-8H,1-3H3,(H2,13,15) |
| InChIKey | JESLZSSQUNIEEH-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |