C10H16ClN2- — CID 18327270
4-N,4-N-diethylbenzene-1,4-diamine chloride (PubChem CID 18327270) has the molecular formula C10H16ClN2- and a molecular weight of 199.71 g/mol. Its IUPAC name is 4-N,4-N-diethylbenzene-1,4-diamine chloride.
| Compound Name | 4-N,4-N-diethylbenzene-1,4-diamine chloride |
|---|---|
| PubChem CID | 18327270 |
| Molecular Formula | C10H16ClN2- |
| Molecular Weight | 199.71 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 4-N,4-N-diethylbenzene-1,4-diamine chloride |
| SMILES | CCN(CC)c1ccc(N)cc1.[Cl-] |
| InChI | InChI=1S/C10H16N2.ClH/c1-3-12(4-2)10-7-5-9(11)6-8-10;/h5-8H,3-4,11H2,1-2H3;1H/p-1 |
| InChIKey | XTBFKMDOQMQYPP-UHFFFAOYSA-M |
| XLogP | -0.88 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.71 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|