C12H19FN2O2 — CID 88776124
4-N,4-N-diethylbenzene-1,4-diamine;2-fluoroacetic acid (PubChem CID 88776124) has the molecular formula C12H19FN2O2 and a molecular weight of 242.29 g/mol. Its IUPAC name is 4-N,4-N-diethylbenzene-1,4-diamine;2-fluoroacetic acid.
| Compound Name | 4-N,4-N-diethylbenzene-1,4-diamine;2-fluoroacetic acid |
|---|---|
| PubChem CID | 88776124 |
| Molecular Formula | C12H19FN2O2 |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 4-N,4-N-diethylbenzene-1,4-diamine;2-fluoroacetic acid |
| SMILES | CCN(CC)c1ccc(N)cc1.O=C(O)CF |
| InChI | InChI=1S/C10H16N2.C2H3FO2/c1-3-12(4-2)10-7-5-9(11)6-8-10;3-1-2(4)5/h5-8H,3-4,11H2,1-2H3;1H2,(H,4,5) |
| InChIKey | QVRGSSWVNXJMHZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|