C11H5F6IO4 — CID 71744238
[iodo-phenyl-(2,2,2-trifluoroacetyl)oxymethyl] 2,2,2-trifluoroacetate (PubChem CID 71744238) has the molecular formula C11H5F6IO4 and a molecular weight of 442.05 g/mol. Its IUPAC name is [iodo-phenyl-(2,2,2-trifluoroacetyl)oxymethyl] 2,2,2-trifluoroacetate.
| Compound Name | [iodo-phenyl-(2,2,2-trifluoroacetyl)oxymethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 71744238 |
| Molecular Formula | C11H5F6IO4 |
| Molecular Weight | 442.05 g/mol |
| Exact Mass | 441.91 |
| IUPAC Name | [iodo-phenyl-(2,2,2-trifluoroacetyl)oxymethyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(OC(I)(OC(=O)C(F)(F)F)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H5F6IO4/c12-9(13,14)7(19)21-11(18,6-4-2-1-3-5-6)22-8(20)10(15,16)17/h1-5H |
| InChIKey | ZRRNRXVSPKLYHI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.05 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|