C16H11F5O2 — CID 71365812
(2,2-difluoro-1,1-diphenylethyl) 2,2,2-trifluoroacetate (PubChem CID 71365812) has the molecular formula C16H11F5O2 and a molecular weight of 330.25 g/mol. Its IUPAC name is (2,2-difluoro-1,1-diphenylethyl) 2,2,2-trifluoroacetate.
| Compound Name | (2,2-difluoro-1,1-diphenylethyl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 71365812 |
| Molecular Formula | C16H11F5O2 |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | (2,2-difluoro-1,1-diphenylethyl) 2,2,2-trifluoroacetate |
| SMILES | O=C(OC(c1ccccc1)(c1ccccc1)C(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H11F5O2/c17-13(18)15(11-7-3-1-4-8-11,12-9-5-2-6-10-12)23-14(22)16(19,20)21/h1-10,13H |
| InChIKey | PSKFXOZREMYLNU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |