C11H10F4O2 — CID 154716345
(2-fluoro-1-phenylpropyl) 2,2,2-trifluoroacetate (PubChem CID 154716345) has the molecular formula C11H10F4O2 and a molecular weight of 250.19 g/mol. Its IUPAC name is (2-fluoro-1-phenylpropyl) 2,2,2-trifluoroacetate.
| Compound Name | (2-fluoro-1-phenylpropyl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 154716345 |
| Molecular Formula | C11H10F4O2 |
| Molecular Weight | 250.19 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | (2-fluoro-1-phenylpropyl) 2,2,2-trifluoroacetate |
| SMILES | CC(F)C(OC(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C11H10F4O2/c1-7(12)9(8-5-3-2-4-6-8)17-10(16)11(13,14)15/h2-7,9H,1H3 |
| InChIKey | HERLCRQETSYMOV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.19 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |