C19H19F3N2O3 — CID 143116125
[1-amino-3-[4-(dimethylamino)phenyl]-1-oxo-3-phenylpropan-2-yl] 2,2,2-trifluoroacetate (PubChem CID 143116125) has the molecular formula C19H19F3N2O3 and a molecular weight of 380.37 g/mol. Its IUPAC name is [1-amino-3-[4-(dimethylamino)phenyl]-1-oxo-3-phenylpropan-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [1-amino-3-[4-(dimethylamino)phenyl]-1-oxo-3-phenylpropan-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 143116125 |
| Molecular Formula | C19H19F3N2O3 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | [1-amino-3-[4-(dimethylamino)phenyl]-1-oxo-3-phenylpropan-2-yl] 2,2,2-trifluoroacetate |
| SMILES | CN(C)c1ccc(C(c2ccccc2)C(OC(=O)C(F)(F)F)C(N)=O)cc1 |
| InChI | InChI=1S/C19H19F3N2O3/c1-24(2)14-10-8-13(9-11-14)15(12-6-4-3-5-7-12)16(17(23)25)27-18(26)19(20,21)22/h3-11,15-16H,1-2H3,(H2,23,25) |
| InChIKey | DYJPUVAQPPRQRA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|