C25H24F3NO5 — CID 161261137
(2S)-2-(N-methoxyanilino)-3,3-diphenylpropanoic acid;methyl 2,2,2-trifluoroacetate (PubChem CID 161261137) has the molecular formula C25H24F3NO5 and a molecular weight of 475.46 g/mol. Its IUPAC name is (2S)-2-(N-methoxyanilino)-3,3-diphenylpropanoic acid;methyl 2,2,2-trifluoroacetate.
| Compound Name | (2S)-2-(N-methoxyanilino)-3,3-diphenylpropanoic acid;methyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 161261137 |
| Molecular Formula | C25H24F3NO5 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | (2S)-2-(N-methoxyanilino)-3,3-diphenylpropanoic acid;methyl 2,2,2-trifluoroacetate |
| SMILES | COC(=O)C(F)(F)F.CON(c1ccccc1)[C@H](C(=O)O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21NO3.C3H3F3O2/c1-26-23(19-15-9-4-10-16-19)21(22(24)25)20(17-11-5-2-6-12-17)18-13-7-3-8-14-18;1-8-2(7)3(4,5)6/h2-16,20-21H,1H3,(H,24,25);1H3/t21-;/m0./s1 |
| InChIKey | VCOHRDYNEFCDBZ-BOXHHOBZSA-N |
| XLogP | 5.06 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|