C26H32N3O2+ — CID 102110624
ethyl 3,3-bis[4-(dimethylamino)phenyl]-2-pyridin-1-ium-1-ylpropanoate (PubChem CID 102110624) has the molecular formula C26H32N3O2+ and a molecular weight of 418.56 g/mol. Its IUPAC name is ethyl 3,3-bis[4-(dimethylamino)phenyl]-2-pyridin-1-ium-1-ylpropanoate.
| Compound Name | ethyl 3,3-bis[4-(dimethylamino)phenyl]-2-pyridin-1-ium-1-ylpropanoate |
|---|---|
| PubChem CID | 102110624 |
| Molecular Formula | C26H32N3O2+ |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | ethyl 3,3-bis[4-(dimethylamino)phenyl]-2-pyridin-1-ium-1-ylpropanoate |
| SMILES | CCOC(=O)C(C(c1ccc(N(C)C)cc1)c1ccc(N(C)C)cc1)[n+]1ccccc1 |
| InChI | InChI=1S/C26H32N3O2/c1-6-31-26(30)25(29-18-8-7-9-19-29)24(20-10-14-22(15-11-20)27(2)3)21-12-16-23(17-13-21)28(4)5/h7-19,24-25H,6H2,1-5H3/q+1 |
| InChIKey | AVLXIRQNTNLHST-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 36.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|