C22H24N4O4S — CID 45257995
5-[2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-ethoxy-3-oxo-1-phenylpropyl]-4-oxo-2-sulfanylidene-1H-pyrimidin-6-olate (PubChem CID 45257995) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is 5-[2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-ethoxy-3-oxo-1-phenylpropyl]-4-oxo-2-sulfanylidene-1H-pyrimidin-6-olate.
| Compound Name | 5-[2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-ethoxy-3-oxo-1-phenylpropyl]-4-oxo-2-sulfanylidene-1H-pyrimidin-6-olate |
|---|---|
| PubChem CID | 45257995 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 5-[2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-ethoxy-3-oxo-1-phenylpropyl]-4-oxo-2-sulfanylidene-1H-pyrimidin-6-olate |
| SMILES | CCOC(=O)C(C(c1ccccc1)c1c([O-])[nH]c(=S)[nH]c1=O)[n+]1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C22H24N4O4S/c1-4-30-21(29)18(26-12-10-15(11-13-26)25(2)3)16(14-8-6-5-7-9-14)17-19(27)23-22(31)24-20(17)28/h5-13,16,18H,4H2,1-3H3,(H2-,23,24,27,28,31) |
| InChIKey | ISBGMWNLQGJAIN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 105.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|