C18H20N2O7 — CID 123807002
diethyl 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)-phenylmethyl]propanedioate (PubChem CID 123807002) has the molecular formula C18H20N2O7 and a molecular weight of 376.37 g/mol. Its IUPAC name is diethyl 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)-phenylmethyl]propanedioate.
| Compound Name | diethyl 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)-phenylmethyl]propanedioate |
|---|---|
| PubChem CID | 123807002 |
| Molecular Formula | C18H20N2O7 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | diethyl 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)-phenylmethyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(c1ccccc1)c1c(O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H20N2O7/c1-3-26-16(23)13(17(24)27-4-2)11(10-8-6-5-7-9-10)12-14(21)19-18(25)20-15(12)22/h5-9,11,13H,3-4H2,1-2H3,(H3,19,20,21,22,25) |
| InChIKey | FBIYHOPIXPKJHB-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 138.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|