C15H16N2O4 — CID 29178161
6-hydroxy-5-[(1S)-3-oxo-1-phenylpentyl]-1H-pyrimidine-2,4-dione (PubChem CID 29178161) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 6-hydroxy-5-[(1S)-3-oxo-1-phenylpentyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-[(1S)-3-oxo-1-phenylpentyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 29178161 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 6-hydroxy-5-[(1S)-3-oxo-1-phenylpentyl]-1H-pyrimidine-2,4-dione |
| SMILES | CCC(=O)C[C@@H](c1ccccc1)c1c(O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H16N2O4/c1-2-10(18)8-11(9-6-4-3-5-7-9)12-13(19)16-15(21)17-14(12)20/h3-7,11H,2,8H2,1H3,(H3,16,17,19,20,21)/t11-/m0/s1 |
| InChIKey | VNYPBMSVPQTWFY-NSHDSACASA-N |
| XLogP | 1.27 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |