C10H11F2NO — CID 155931604
(2R,3R)-2,3-difluoro-2-methyl-3-phenylpropanamide (PubChem CID 155931604) has the molecular formula C10H11F2NO and a molecular weight of 199.20 g/mol. Its IUPAC name is (2R,3R)-2,3-difluoro-2-methyl-3-phenylpropanamide.
| Compound Name | (2R,3R)-2,3-difluoro-2-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 155931604 |
| Molecular Formula | C10H11F2NO |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | (2R,3R)-2,3-difluoro-2-methyl-3-phenylpropanamide |
| SMILES | C[C@@](F)(C(N)=O)[C@H](F)c1ccccc1 |
| InChI | InChI=1S/C10H11F2NO/c1-10(12,9(13)14)8(11)7-5-3-2-4-6-7/h2-6,8H,1H3,(H2,13,14)/t8-,10+/m1/s1 |
| InChIKey | JTDMHJFUOIDDEW-SCZZXKLOSA-N |
| XLogP | 1.91 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |