C10H14N2O2 — CID 11424108
(2S,3S)-2-amino-3-hydroxy-2-methyl-3-phenylpropanamide (PubChem CID 11424108) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is (2S,3S)-2-amino-3-hydroxy-2-methyl-3-phenylpropanamide.
| Compound Name | (2S,3S)-2-amino-3-hydroxy-2-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 11424108 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | (2S,3S)-2-amino-3-hydroxy-2-methyl-3-phenylpropanamide |
| SMILES | C[C@@](N)(C(N)=O)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C10H14N2O2/c1-10(12,9(11)14)8(13)7-5-3-2-4-6-7/h2-6,8,13H,12H2,1H3,(H2,11,14)/t8-,10-/m0/s1 |
| InChIKey | RVOQHKRTVITDSA-WPRPVWTQSA-N |
| XLogP | -0.08 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |