About [oxo(diphenyl)-λ5-iodanyl] 2,2,2-trifluoroacetate
[oxo(diphenyl)-λ5-iodanyl] 2,2,2-trifluoroacetate (PubChem CID 23319454) has the molecular formula C14H10F3IO3
and a molecular weight of 410.13 g/mol. Its IUPAC name is [oxo(diphenyl)-λ5-iodanyl] 2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | [oxo(diphenyl)-λ5-iodanyl] 2,2,2-trifluoroacetate |
| PubChem CID | 23319454 |
| Molecular Formula | C14H10F3IO3 |
| Molecular Weight | 410.13 g/mol |
| Exact Mass | 409.96 |
| IUPAC Name | [oxo(diphenyl)-λ5-iodanyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(OI(=O)(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C14H10F3IO3/c15-14(16,17)13(19)21-18(20,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | PIQQZQXZVKNVAI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.13 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [oxo(diphenyl)-λ5-iodanyl] 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [oxo(diphenyl)-λ5-iodanyl] 2,2,2-trifluoroacetate?
The IUPAC name of [oxo(diphenyl)-λ5-iodanyl] 2,2,2-trifluoroacetate (CID 23319454) is [oxo(diphenyl)-λ5-iodanyl] 2,2,2-trifluoroacetate.
What is the SMILES notation for [oxo(diphenyl)-λ5-iodanyl] 2,2,2-trifluoroacetate?
The canonical SMILES for [oxo(diphenyl)-λ5-iodanyl] 2,2,2-trifluoroacetate is O=C(OI(=O)(c1ccccc1)c1ccccc1)C(F)(F)F.
What is the InChIKey of [oxo(diphenyl)-λ5-iodanyl] 2,2,2-trifluoroacetate?
The InChIKey is PIQQZQXZVKNVAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F3IO3/c15-14(16,17)13(19)21-18(20,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H.
What are the key properties of [oxo(diphenyl)-λ5-iodanyl] 2,2,2-trifluoroacetate?
[oxo(diphenyl)-λ5-iodanyl] 2,2,2-trifluoroacetate has a molecular weight of 410.13 g/mol, XLogP of 4.13, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [oxo(diphenyl)-λ5-iodanyl] 2,2,2-trifluoroacetate is sourced from PubChem (CID 23319454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).