C36H37F5O7S2 — CID 123461557
[1-[dihydroxy-oxo-(triphenyl-λ4-sulfanyl)-λ6-sulfanyl]-1,1,3,3,3-pentafluoropropan-2-yl] 5-(2-methylprop-2-enoyloxy)adamantane-2-carboxylate (PubChem CID 123461557) has the molecular formula C36H37F5O7S2 and a molecular weight of 740.81 g/mol. Its IUPAC name is [1-[dihydroxy-oxo-(triphenyl-λ4-sulfanyl)-λ6-sulfanyl]-1,1,3,3,3-pentafluoropropan-2-yl] 5-(2-methylprop-2-enoyloxy)adamantane-2-carboxylate.
| Compound Name | [1-[dihydroxy-oxo-(triphenyl-λ4-sulfanyl)-λ6-sulfanyl]-1,1,3,3,3-pentafluoropropan-2-yl] 5-(2-methylprop-2-enoyloxy)adamantane-2-carboxylate |
|---|---|
| PubChem CID | 123461557 |
| Molecular Formula | C36H37F5O7S2 |
| Molecular Weight | 740.81 g/mol |
| Exact Mass | 740.19 |
| IUPAC Name | [1-[dihydroxy-oxo-(triphenyl-λ4-sulfanyl)-λ6-sulfanyl]-1,1,3,3,3-pentafluoropropan-2-yl] 5-(2-methylprop-2-enoyloxy)adamantane-2-carboxylate |
| SMILES | C=C(C)C(=O)OC12CC3CC(C1)C(C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(O)(O)S(c1ccccc1)(c1ccccc1)c1ccccc1)C(C3)C2 |
| InChI | InChI=1S/C36H37F5O7S2/c1-23(2)31(42)48-34-20-24-18-25(21-34)30(26(19-24)22-34)32(43)47-33(35(37,38)39)36(40,41)50(44,45,46)49(27-12-6-3-7-13-27,28-14-8-4-9-15-28)29-16-10-5-11-17-29/h3-17,24-26,30,33H,1,18-22H2,2H3,(H2,44,45,46) |
| InChIKey | YDGRTLLCYIWVSZ-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.81 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|