C32H33F3O5S2 — CID 161293370
4-(1-adamantyloxy)-1,1,1-trifluoro-4-oxobutane-2-sulfonate;triphenylsulfanium (PubChem CID 161293370) has the molecular formula C32H33F3O5S2 and a molecular weight of 618.74 g/mol. Its IUPAC name is 4-(1-adamantyloxy)-1,1,1-trifluoro-4-oxobutane-2-sulfonate;triphenylsulfanium.
| Compound Name | 4-(1-adamantyloxy)-1,1,1-trifluoro-4-oxobutane-2-sulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 161293370 |
| Molecular Formula | C32H33F3O5S2 |
| Molecular Weight | 618.74 g/mol |
| Exact Mass | 618.17 |
| IUPAC Name | 4-(1-adamantyloxy)-1,1,1-trifluoro-4-oxobutane-2-sulfonate;triphenylsulfanium |
| SMILES | O=C(CC(C(F)(F)F)S(=O)(=O)[O-])OC12CC3CC(CC(C3)C1)C2.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C14H19F3O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;15-14(16,17)11(23(19,20)21)4-12(18)22-13-5-8-1-9(6-13)3-10(2-8)7-13/h1-15H;8-11H,1-7H2,(H,19,20,21)/q+1;/p-1 |
| InChIKey | VGQOTWVBPJFNIG-UHFFFAOYSA-M |
| XLogP | 7.15 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.74 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|