C42H56O8S2 — CID 162073805
2-(2,2-dimethylbutanoyloxy)ethanesulfonate;(3-hydroxy-1-adamantyl) 2,2-dimethylbutanoate;triphenylsulfanium (PubChem CID 162073805) has the molecular formula C42H56O8S2 and a molecular weight of 753.04 g/mol. Its IUPAC name is 2-(2,2-dimethylbutanoyloxy)ethanesulfonate;(3-hydroxy-1-adamantyl) 2,2-dimethylbutanoate;triphenylsulfanium.
| Compound Name | 2-(2,2-dimethylbutanoyloxy)ethanesulfonate;(3-hydroxy-1-adamantyl) 2,2-dimethylbutanoate;triphenylsulfanium |
|---|---|
| PubChem CID | 162073805 |
| Molecular Formula | C42H56O8S2 |
| Molecular Weight | 753.04 g/mol |
| Exact Mass | 752.34 |
| IUPAC Name | 2-(2,2-dimethylbutanoyloxy)ethanesulfonate;(3-hydroxy-1-adamantyl) 2,2-dimethylbutanoate;triphenylsulfanium |
| SMILES | CCC(C)(C)C(=O)OC12CC3CC(CC(O)(C3)C1)C2.CCC(C)(C)C(=O)OCCS(=O)(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C16H26O3.C8H16O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4-14(2,3)13(17)19-16-8-11-5-12(9-16)7-15(18,6-11)10-16;1-4-8(2,3)7(9)13-5-6-14(10,11)12/h1-15H;11-12,18H,4-10H2,1-3H3;4-6H2,1-3H3,(H,10,11,12)/q+1;;/p-1 |
| InChIKey | ZBLDMKDXEXBKIV-UHFFFAOYSA-M |
| XLogP | 8.34 |
| TPSA | 130.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.04 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|