C30H30F2O6S2 — CID 87205461
1,1-difluoro-2-[(3-hydroxy-1-adamantyl)oxy]-2-oxoethanesulfonate;triphenylsulfanium (PubChem CID 87205461) has the molecular formula C30H30F2O6S2 and a molecular weight of 588.69 g/mol. Its IUPAC name is 1,1-difluoro-2-[(3-hydroxy-1-adamantyl)oxy]-2-oxoethanesulfonate;triphenylsulfanium.
| Compound Name | 1,1-difluoro-2-[(3-hydroxy-1-adamantyl)oxy]-2-oxoethanesulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 87205461 |
| Molecular Formula | C30H30F2O6S2 |
| Molecular Weight | 588.69 g/mol |
| Exact Mass | 588.15 |
| IUPAC Name | 1,1-difluoro-2-[(3-hydroxy-1-adamantyl)oxy]-2-oxoethanesulfonate;triphenylsulfanium |
| SMILES | O=C(OC12CC3CC(CC(O)(C3)C1)C2)C(F)(F)S(=O)(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C12H16F2O6S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;13-12(14,21(17,18)19)9(15)20-11-4-7-1-8(5-11)3-10(16,2-7)6-11/h1-15H;7-8,16H,1-6H2,(H,17,18,19)/q+1;/p-1 |
| InChIKey | UVYTVJJBCFUXOS-UHFFFAOYSA-M |
| XLogP | 5.53 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.69 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|