C35H36F8O5S2 — CID 159315142
(4-methylphenyl)-diphenylsulfanium;1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-4-(3-hydroxy-1-adamantyl)butoxy]ethanesulfonate (PubChem CID 159315142) has the molecular formula C35H36F8O5S2 and a molecular weight of 752.79 g/mol. Its IUPAC name is (4-methylphenyl)-diphenylsulfanium;1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-4-(3-hydroxy-1-adamantyl)butoxy]ethanesulfonate.
| Compound Name | (4-methylphenyl)-diphenylsulfanium;1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-4-(3-hydroxy-1-adamantyl)butoxy]ethanesulfonate |
|---|---|
| PubChem CID | 159315142 |
| Molecular Formula | C35H36F8O5S2 |
| Molecular Weight | 752.79 g/mol |
| Exact Mass | 752.19 |
| IUPAC Name | (4-methylphenyl)-diphenylsulfanium;1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-4-(3-hydroxy-1-adamantyl)butoxy]ethanesulfonate |
| SMILES | Cc1ccc([S+](c2ccccc2)c2ccccc2)cc1.O=S(=O)([O-])C(F)(F)C(F)(F)OC(F)(F)C(F)(F)CCC12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C19H17S.C16H20F8O5S/c1-16-12-14-19(15-13-16)20(17-8-4-2-5-9-17)18-10-6-3-7-11-18;17-13(18,14(19,20)29-15(21,22)16(23,24)30(26,27)28)2-1-11-4-9-3-10(5-11)7-12(25,6-9)8-11/h2-15H,1H3;9-10,25H,1-8H2,(H,26,27,28)/q+1;/p-1 |
| InChIKey | LDAROIGOWQQGIF-UHFFFAOYSA-M |
| XLogP | 9.16 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.79 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|