C24H30F2O7S2 — CID 158411302
1,1-difluoro-2-[(4-hydroxy-1-adamantyl)oxy]-2-oxoethanesulfonate;1-phenyl-2-(thiolan-1-ium-1-yl)ethanone (PubChem CID 158411302) has the molecular formula C24H30F2O7S2 and a molecular weight of 532.63 g/mol. Its IUPAC name is 1,1-difluoro-2-[(4-hydroxy-1-adamantyl)oxy]-2-oxoethanesulfonate;1-phenyl-2-(thiolan-1-ium-1-yl)ethanone.
| Compound Name | 1,1-difluoro-2-[(4-hydroxy-1-adamantyl)oxy]-2-oxoethanesulfonate;1-phenyl-2-(thiolan-1-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 158411302 |
| Molecular Formula | C24H30F2O7S2 |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | 1,1-difluoro-2-[(4-hydroxy-1-adamantyl)oxy]-2-oxoethanesulfonate;1-phenyl-2-(thiolan-1-ium-1-yl)ethanone |
| SMILES | O=C(C[S+]1CCCC1)c1ccccc1.O=C(OC12CC3CC(C1)C(O)C(C3)C2)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C12H16F2O6S.C12H15OS/c13-12(14,21(17,18)19)10(16)20-11-3-6-1-7(4-11)9(15)8(2-6)5-11;13-12(10-14-8-4-5-9-14)11-6-2-1-3-7-11/h6-9,15H,1-5H2,(H,17,18,19);1-3,6-7H,4-5,8-10H2/q;+1/p-1 |
| InChIKey | GZIQTKFUOBHDNM-UHFFFAOYSA-M |
| XLogP | 2.89 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|