C32H43F2O9S- — CID 154598405
2-[[4-[2-[(2-ethyl-2-adamantyl)oxycarbonyl]cyclohexanecarbonyl]oxy-1-adamantyl]oxy]-1,1-difluoro-2-oxoethanesulfonate (PubChem CID 154598405) has the molecular formula C32H43F2O9S- and a molecular weight of 641.75 g/mol. Its IUPAC name is 2-[[4-[2-[(2-ethyl-2-adamantyl)oxycarbonyl]cyclohexanecarbonyl]oxy-1-adamantyl]oxy]-1,1-difluoro-2-oxoethanesulfonate.
| Compound Name | 2-[[4-[2-[(2-ethyl-2-adamantyl)oxycarbonyl]cyclohexanecarbonyl]oxy-1-adamantyl]oxy]-1,1-difluoro-2-oxoethanesulfonate |
|---|---|
| PubChem CID | 154598405 |
| Molecular Formula | C32H43F2O9S- |
| Molecular Weight | 641.75 g/mol |
| Exact Mass | 641.26 |
| IUPAC Name | 2-[[4-[2-[(2-ethyl-2-adamantyl)oxycarbonyl]cyclohexanecarbonyl]oxy-1-adamantyl]oxy]-1,1-difluoro-2-oxoethanesulfonate |
| SMILES | CCC1(OC(=O)C2CCCCC2C(=O)OC2C3CC4CC2CC(OC(=O)C(F)(F)S(=O)(=O)[O-])(C4)C3)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C32H44F2O9S/c1-2-31(22-10-17-7-18(12-22)13-23(31)11-17)42-28(36)25-6-4-3-5-24(25)27(35)41-26-20-8-19-9-21(26)16-30(14-19,15-20)43-29(37)32(33,34)44(38,39)40/h17-26H,2-16H2,1H3,(H,38,39,40)/p-1 |
| InChIKey | QFRXHGJHEAZJKJ-UHFFFAOYSA-M |
| XLogP | 5.11 |
| TPSA | 136.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.75 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|