C26H35F2O8S- — CID 154598364
2-[[3-[2-[(2-ethyl-2-adamantyl)oxy]-2-oxoethoxy]-1-adamantyl]oxy]-1,1-difluoro-2-oxoethanesulfonate (PubChem CID 154598364) has the molecular formula C26H35F2O8S- and a molecular weight of 545.62 g/mol. Its IUPAC name is 2-[[3-[2-[(2-ethyl-2-adamantyl)oxy]-2-oxoethoxy]-1-adamantyl]oxy]-1,1-difluoro-2-oxoethanesulfonate.
| Compound Name | 2-[[3-[2-[(2-ethyl-2-adamantyl)oxy]-2-oxoethoxy]-1-adamantyl]oxy]-1,1-difluoro-2-oxoethanesulfonate |
|---|---|
| PubChem CID | 154598364 |
| Molecular Formula | C26H35F2O8S- |
| Molecular Weight | 545.62 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | 2-[[3-[2-[(2-ethyl-2-adamantyl)oxy]-2-oxoethoxy]-1-adamantyl]oxy]-1,1-difluoro-2-oxoethanesulfonate |
| SMILES | CCC1(OC(=O)COC23CC4CC(C2)CC(OC(=O)C(F)(F)S(=O)(=O)[O-])(C4)C3)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C26H36F2O8S/c1-2-25(19-5-15-3-16(7-19)8-20(25)6-15)35-21(29)13-34-23-9-17-4-18(10-23)12-24(11-17,14-23)36-22(30)26(27,28)37(31,32)33/h15-20H,2-14H2,1H3,(H,31,32,33)/p-1 |
| InChIKey | GFCQDBLWOFQRQC-UHFFFAOYSA-M |
| XLogP | 3.92 |
| TPSA | 119.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.62 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|