C23H36O5 — CID 159745081
[3-[2-(1-ethylcyclopentyl)oxy-2-oxoethoxy]-1-adamantyl] 2-methylpropanoate (PubChem CID 159745081) has the molecular formula C23H36O5 and a molecular weight of 392.54 g/mol. Its IUPAC name is [3-[2-(1-ethylcyclopentyl)oxy-2-oxoethoxy]-1-adamantyl] 2-methylpropanoate.
| Compound Name | [3-[2-(1-ethylcyclopentyl)oxy-2-oxoethoxy]-1-adamantyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 159745081 |
| Molecular Formula | C23H36O5 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | [3-[2-(1-ethylcyclopentyl)oxy-2-oxoethoxy]-1-adamantyl] 2-methylpropanoate |
| SMILES | CCC1(OC(=O)COC23CC4CC(C2)CC(OC(=O)C(C)C)(C4)C3)CCCC1 |
| InChI | InChI=1S/C23H36O5/c1-4-21(7-5-6-8-21)27-19(24)14-26-22-10-17-9-18(11-22)13-23(12-17,15-22)28-20(25)16(2)3/h16-18H,4-15H2,1-3H3 |
| InChIKey | NBNCKCSQXHMRQT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |