C20H20F2O8S — CID 170191340
(4-oxo-1-adamantyl) 2,2-difluoro-2-phenylmethoxycarbonyloxysulfonylacetate (PubChem CID 170191340) has the molecular formula C20H20F2O8S and a molecular weight of 458.44 g/mol. Its IUPAC name is (4-oxo-1-adamantyl) 2,2-difluoro-2-phenylmethoxycarbonyloxysulfonylacetate.
| Compound Name | (4-oxo-1-adamantyl) 2,2-difluoro-2-phenylmethoxycarbonyloxysulfonylacetate |
|---|---|
| PubChem CID | 170191340 |
| Molecular Formula | C20H20F2O8S |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | (4-oxo-1-adamantyl) 2,2-difluoro-2-phenylmethoxycarbonyloxysulfonylacetate |
| SMILES | O=C(OCc1ccccc1)OS(=O)(=O)C(F)(F)C(=O)OC12CC3CC(C1)C(=O)C(C3)C2 |
| InChI | InChI=1S/C20H20F2O8S/c21-20(22,31(26,27)30-18(25)28-11-12-4-2-1-3-5-12)17(24)29-19-8-13-6-14(9-19)16(23)15(7-13)10-19/h1-5,13-15H,6-11H2 |
| InChIKey | HCCFZHCMADJVLH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|